C29H19Cl2N3O7 — CID 98415281
[2-[(3R)-5-(4-chlorophenyl)-3-(furan-2-yl)-3,4-dihydropyrazol-2-yl]-2-oxoethyl] 2-(4-chloro-3-nitrobenzoyl)benzoate (PubChem CID 98415281) has the molecular formula C29H19Cl2N3O7 and a molecular weight of 592.39 g/mol. Its IUPAC name is [2-[(3R)-5-(4-chlorophenyl)-3-(furan-2-yl)-3,4-dihydropyrazol-2-yl]-2-oxoethyl] 2-(4-chloro-3-nitrobenzoyl)benzoate.
| Compound Name | [2-[(3R)-5-(4-chlorophenyl)-3-(furan-2-yl)-3,4-dihydropyrazol-2-yl]-2-oxoethyl] 2-(4-chloro-3-nitrobenzoyl)benzoate |
|---|---|
| PubChem CID | 98415281 |
| Molecular Formula | C29H19Cl2N3O7 |
| Molecular Weight | 592.39 g/mol |
| Exact Mass | 591.06 |
| IUPAC Name | [2-[(3R)-5-(4-chlorophenyl)-3-(furan-2-yl)-3,4-dihydropyrazol-2-yl]-2-oxoethyl] 2-(4-chloro-3-nitrobenzoyl)benzoate |
| SMILES | O=C(OCC(=O)N1N=C(c2ccc(Cl)cc2)C[C@@H]1c1ccco1)c1ccccc1C(=O)c1ccc(Cl)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C29H19Cl2N3O7/c30-19-10-7-17(8-11-19)23-15-25(26-6-3-13-40-26)33(32-23)27(35)16-41-29(37)21-5-2-1-4-20(21)28(36)18-9-12-22(31)24(14-18)34(38)39/h1-14,25H,15-16H2/t25-/m1/s1 |
| InChIKey | UWSPTYVBRIHUMX-RUZDIDTESA-N |
| XLogP | 6.26 |
| TPSA | 132.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 592.39 |
| LogP ≤ 5 | 6.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|