C25H23N3O8 — CID 41101784
[2-[(3S)-3-(furan-2-yl)-5-(4-methylphenyl)-3,4-dihydropyrazol-2-yl]-2-oxoethyl] 4,5-dimethoxy-2-nitrobenzoate (PubChem CID 41101784) has the molecular formula C25H23N3O8 and a molecular weight of 493.47 g/mol. Its IUPAC name is [2-[(3S)-3-(furan-2-yl)-5-(4-methylphenyl)-3,4-dihydropyrazol-2-yl]-2-oxoethyl] 4,5-dimethoxy-2-nitrobenzoate.
| Compound Name | [2-[(3S)-3-(furan-2-yl)-5-(4-methylphenyl)-3,4-dihydropyrazol-2-yl]-2-oxoethyl] 4,5-dimethoxy-2-nitrobenzoate |
|---|---|
| PubChem CID | 41101784 |
| Molecular Formula | C25H23N3O8 |
| Molecular Weight | 493.47 g/mol |
| Exact Mass | 493.15 |
| IUPAC Name | [2-[(3S)-3-(furan-2-yl)-5-(4-methylphenyl)-3,4-dihydropyrazol-2-yl]-2-oxoethyl] 4,5-dimethoxy-2-nitrobenzoate |
| SMILES | COc1cc(C(=O)OCC(=O)N2N=C(c3ccc(C)cc3)C[C@H]2c2ccco2)c([N+](=O)[O-])cc1OC |
| InChI | InChI=1S/C25H23N3O8/c1-15-6-8-16(9-7-15)18-12-20(21-5-4-10-35-21)27(26-18)24(29)14-36-25(30)17-11-22(33-2)23(34-3)13-19(17)28(31)32/h4-11,13,20H,12,14H2,1-3H3/t20-/m0/s1 |
| InChIKey | ZMGOQHUNINLTGY-FQEVSTJZSA-N |
| XLogP | 4.05 |
| TPSA | 133.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.47 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|