C22H17FN2O5 — CID 55356429
[2-[3,5-bis(furan-2-yl)-3,4-dihydropyrazol-2-yl]-2-oxoethyl] (E)-3-(2-fluorophenyl)prop-2-enoate (PubChem CID 55356429) has the molecular formula C22H17FN2O5 and a molecular weight of 408.39 g/mol. Its IUPAC name is [2-[3,5-bis(furan-2-yl)-3,4-dihydropyrazol-2-yl]-2-oxoethyl] (E)-3-(2-fluorophenyl)prop-2-enoate.
| Compound Name | [2-[3,5-bis(furan-2-yl)-3,4-dihydropyrazol-2-yl]-2-oxoethyl] (E)-3-(2-fluorophenyl)prop-2-enoate |
|---|---|
| PubChem CID | 55356429 |
| Molecular Formula | C22H17FN2O5 |
| Molecular Weight | 408.39 g/mol |
| Exact Mass | 408.11 |
| IUPAC Name | [2-[3,5-bis(furan-2-yl)-3,4-dihydropyrazol-2-yl]-2-oxoethyl] (E)-3-(2-fluorophenyl)prop-2-enoate |
| SMILES | O=C(/C=C/c1ccccc1F)OCC(=O)N1N=C(c2ccco2)CC1c1ccco1 |
| InChI | InChI=1S/C22H17FN2O5/c23-16-6-2-1-5-15(16)9-10-22(27)30-14-21(26)25-18(20-8-4-12-29-20)13-17(24-25)19-7-3-11-28-19/h1-12,18H,13-14H2/b10-9+ |
| InChIKey | XBFWAZNAYZHHOP-MDZDMXLPSA-N |
| XLogP | 3.95 |
| TPSA | 85.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.39 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|