C19H16N2O4 — CID 78503039
[2-(2-methyl-2,3-dihydroindol-1-yl)-2-oxoethyl] 2-cyano-3-(furan-2-yl)prop-2-enoate (PubChem CID 78503039) has the molecular formula C19H16N2O4 and a molecular weight of 336.35 g/mol. Its IUPAC name is [2-(2-methyl-2,3-dihydroindol-1-yl)-2-oxoethyl] 2-cyano-3-(furan-2-yl)prop-2-enoate.
| Compound Name | [2-(2-methyl-2,3-dihydroindol-1-yl)-2-oxoethyl] 2-cyano-3-(furan-2-yl)prop-2-enoate |
|---|---|
| PubChem CID | 78503039 |
| Molecular Formula | C19H16N2O4 |
| Molecular Weight | 336.35 g/mol |
| Exact Mass | 336.11 |
| IUPAC Name | [2-(2-methyl-2,3-dihydroindol-1-yl)-2-oxoethyl] 2-cyano-3-(furan-2-yl)prop-2-enoate |
| SMILES | CC1Cc2ccccc2N1C(=O)COC(=O)C(C#N)=Cc1ccco1 |
| InChI | InChI=1S/C19H16N2O4/c1-13-9-14-5-2-3-7-17(14)21(13)18(22)12-25-19(23)15(11-20)10-16-6-4-8-24-16/h2-8,10,13H,9,12H2,1H3 |
| InChIKey | LQCMCKYYYVSMDK-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 83.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.35 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|