C25H31NO4 — CID 7854419
[2-(2,5-diethylphenyl)-2-oxoethyl] 2-[(4-tert-butylbenzoyl)amino]acetate (PubChem CID 7854419) has the molecular formula C25H31NO4 and a molecular weight of 409.53 g/mol. Its IUPAC name is [2-(2,5-diethylphenyl)-2-oxoethyl] 2-[(4-tert-butylbenzoyl)amino]acetate.
| Compound Name | [2-(2,5-diethylphenyl)-2-oxoethyl] 2-[(4-tert-butylbenzoyl)amino]acetate |
|---|---|
| PubChem CID | 7854419 |
| Molecular Formula | C25H31NO4 |
| Molecular Weight | 409.53 g/mol |
| Exact Mass | 409.23 |
| IUPAC Name | [2-(2,5-diethylphenyl)-2-oxoethyl] 2-[(4-tert-butylbenzoyl)amino]acetate |
| SMILES | CCc1ccc(CC)c(C(=O)COC(=O)CNC(=O)c2ccc(C(C)(C)C)cc2)c1 |
| InChI | InChI=1S/C25H31NO4/c1-6-17-8-9-18(7-2)21(14-17)22(27)16-30-23(28)15-26-24(29)19-10-12-20(13-11-19)25(3,4)5/h8-14H,6-7,15-16H2,1-5H3,(H,26,29) |
| InChIKey | STFNQLOXOGEGIO-UHFFFAOYSA-N |
| XLogP | 4.26 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.53 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |