C25H25N3OS — CID 7855841
(2R)-N-benzyl-N-methyl-2-[1-(4-methylphenyl)benzimidazol-2-yl]sulfanylpropanamide (PubChem CID 7855841) has the molecular formula C25H25N3OS and a molecular weight of 415.56 g/mol. Its IUPAC name is (2R)-N-benzyl-N-methyl-2-[1-(4-methylphenyl)benzimidazol-2-yl]sulfanylpropanamide.
| Compound Name | (2R)-N-benzyl-N-methyl-2-[1-(4-methylphenyl)benzimidazol-2-yl]sulfanylpropanamide |
|---|---|
| PubChem CID | 7855841 |
| Molecular Formula | C25H25N3OS |
| Molecular Weight | 415.56 g/mol |
| Exact Mass | 415.17 |
| IUPAC Name | (2R)-N-benzyl-N-methyl-2-[1-(4-methylphenyl)benzimidazol-2-yl]sulfanylpropanamide |
| SMILES | Cc1ccc(-n2c(S[C@H](C)C(=O)N(C)Cc3ccccc3)nc3ccccc32)cc1 |
| InChI | InChI=1S/C25H25N3OS/c1-18-13-15-21(16-14-18)28-23-12-8-7-11-22(23)26-25(28)30-19(2)24(29)27(3)17-20-9-5-4-6-10-20/h4-16,19H,17H2,1-3H3/t19-/m1/s1 |
| InChIKey | NNOHPRNIMSMKHF-LJQANCHMSA-N |
| XLogP | 5.47 |
| TPSA | 38.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.56 |
| LogP ≤ 5 | 5.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |