C23H20FNO4 — CID 7856125
[2-(3-fluoroanilino)-2-oxoethyl] 2-(2-benzylphenoxy)acetate (PubChem CID 7856125) has the molecular formula C23H20FNO4 and a molecular weight of 393.41 g/mol. Its IUPAC name is [2-(3-fluoroanilino)-2-oxoethyl] 2-(2-benzylphenoxy)acetate.
| Compound Name | [2-(3-fluoroanilino)-2-oxoethyl] 2-(2-benzylphenoxy)acetate |
|---|---|
| PubChem CID | 7856125 |
| Molecular Formula | C23H20FNO4 |
| Molecular Weight | 393.41 g/mol |
| Exact Mass | 393.14 |
| IUPAC Name | [2-(3-fluoroanilino)-2-oxoethyl] 2-(2-benzylphenoxy)acetate |
| SMILES | O=C(COC(=O)COc1ccccc1Cc1ccccc1)Nc1cccc(F)c1 |
| InChI | InChI=1S/C23H20FNO4/c24-19-10-6-11-20(14-19)25-22(26)15-29-23(27)16-28-21-12-5-4-9-18(21)13-17-7-2-1-3-8-17/h1-12,14H,13,15-16H2,(H,25,26) |
| InChIKey | MUNODXFVNFCXRV-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.41 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |