C22H18N3O5+ — CID 78577604
2-(3,4-dihydroxyphenyl)-5,7-dimethyl-5,7-diaza-9-azoniatetracyclo[8.7.0.03,8.011,16]heptadeca-3(8),9,11,13,15-pentaene-4,6,17-trione (PubChem CID 78577604) has the molecular formula C22H18N3O5+ and a molecular weight of 404.40 g/mol. Its IUPAC name is 2-(3,4-dihydroxyphenyl)-5,7-dimethyl-5,7-diaza-9-azoniatetracyclo[8.7.0.03,8.011,16]heptadeca-3(8),9,11,13,15-pentaene-4,6,17-trione.
| Compound Name | 2-(3,4-dihydroxyphenyl)-5,7-dimethyl-5,7-diaza-9-azoniatetracyclo[8.7.0.03,8.011,16]heptadeca-3(8),9,11,13,15-pentaene-4,6,17-trione |
|---|---|
| PubChem CID | 78577604 |
| Molecular Formula | C22H18N3O5+ |
| Molecular Weight | 404.40 g/mol |
| Exact Mass | 404.12 |
| IUPAC Name | 2-(3,4-dihydroxyphenyl)-5,7-dimethyl-5,7-diaza-9-azoniatetracyclo[8.7.0.03,8.011,16]heptadeca-3(8),9,11,13,15-pentaene-4,6,17-trione |
| SMILES | Cn1c2c(c(=O)n(C)c1=O)C(c1ccc(O)c(O)c1)C1C(=O)c3ccccc3C1=[NH+]2 |
| InChI | InChI=1S/C22H17N3O5/c1-24-20-17(21(29)25(2)22(24)30)15(10-7-8-13(26)14(27)9-10)16-18(23-20)11-5-3-4-6-12(11)19(16)28/h3-9,15-16,26-27H,1-2H3/p+1 |
| InChIKey | HJNYKJOKPSQEHB-UHFFFAOYSA-O |
| XLogP | -0.35 |
| TPSA | 115.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.40 |
| LogP ≤ 5 | -0.35 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|