C35H29F3N2O5S2 — CID 78579456
(9S)-9-[3-methoxy-4-[(3-methylphenyl)methoxy]phenyl]-14-[2-(trifluoromethyl)phenyl]-3,7-dithia-5,14-diazapentacyclo[9.5.1.02,10.04,8.012,16]heptadec-4(8)-ene-6,13,15-trione (PubChem CID 78579456) has the molecular formula C35H29F3N2O5S2 and a molecular weight of 678.75 g/mol. Its IUPAC name is (9S)-9-[3-methoxy-4-[(3-methylphenyl)methoxy]phenyl]-14-[2-(trifluoromethyl)phenyl]-3,7-dithia-5,14-diazapentacyclo[9.5.1.02,10.04,8.012,16]heptadec-4(8)-ene-6,13,15-trione.
| Compound Name | (9S)-9-[3-methoxy-4-[(3-methylphenyl)methoxy]phenyl]-14-[2-(trifluoromethyl)phenyl]-3,7-dithia-5,14-diazapentacyclo[9.5.1.02,10.04,8.012,16]heptadec-4(8)-ene-6,13,15-trione |
|---|---|
| PubChem CID | 78579456 |
| Molecular Formula | C35H29F3N2O5S2 |
| Molecular Weight | 678.75 g/mol |
| Exact Mass | 678.15 |
| IUPAC Name | (9S)-9-[3-methoxy-4-[(3-methylphenyl)methoxy]phenyl]-14-[2-(trifluoromethyl)phenyl]-3,7-dithia-5,14-diazapentacyclo[9.5.1.02,10.04,8.012,16]heptadec-4(8)-ene-6,13,15-trione |
| SMILES | COc1cc(C2c3sc(=O)[nH]c3SC3C4CC(C5C(=O)N(c6ccccc6C(F)(F)F)C(=O)C45)C23)ccc1OCc1cccc(C)c1 |
| InChI | InChI=1S/C35H29F3N2O5S2/c1-16-6-5-7-17(12-16)15-45-23-11-10-18(13-24(23)44-2)25-26-19-14-20(29(26)46-31-30(25)47-34(43)39-31)28-27(19)32(41)40(33(28)42)22-9-4-3-8-21(22)35(36,37)38/h3-13,19-20,25-29H,14-15H2,1-2H3,(H,39,43) |
| InChIKey | ZQACMTSFORMWNE-UHFFFAOYSA-N |
| XLogP | 7.03 |
| TPSA | 88.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 678.75 |
| LogP ≤ 5 | 7.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'thiaz_ene_E(8)', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|