C35H27F4N3O6S2 — CID 78579579
2-[4-[(9S)-14-(4-fluorophenyl)-6,13,15-trioxo-3,7-dithia-5,14-diazapentacyclo[9.5.1.02,10.04,8.012,16]heptadec-4(8)-en-9-yl]-2-methoxyphenoxy]-N-[2-(trifluoromethyl)phenyl]acetamide (PubChem CID 78579579) has the molecular formula C35H27F4N3O6S2 and a molecular weight of 725.74 g/mol. Its IUPAC name is 2-[4-[(9S)-14-(4-fluorophenyl)-6,13,15-trioxo-3,7-dithia-5,14-diazapentacyclo[9.5.1.02,10.04,8.012,16]heptadec-4(8)-en-9-yl]-2-methoxyphenoxy]-N-[2-(trifluoromethyl)phenyl]acetamide.
| Compound Name | 2-[4-[(9S)-14-(4-fluorophenyl)-6,13,15-trioxo-3,7-dithia-5,14-diazapentacyclo[9.5.1.02,10.04,8.012,16]heptadec-4(8)-en-9-yl]-2-methoxyphenoxy]-N-[2-(trifluoromethyl)phenyl]acetamide |
|---|---|
| PubChem CID | 78579579 |
| Molecular Formula | C35H27F4N3O6S2 |
| Molecular Weight | 725.74 g/mol |
| Exact Mass | 725.13 |
| IUPAC Name | 2-[4-[(9S)-14-(4-fluorophenyl)-6,13,15-trioxo-3,7-dithia-5,14-diazapentacyclo[9.5.1.02,10.04,8.012,16]heptadec-4(8)-en-9-yl]-2-methoxyphenoxy]-N-[2-(trifluoromethyl)phenyl]acetamide |
| SMILES | COc1cc(C2c3sc(=O)[nH]c3SC3C4CC(C5C(=O)N(c6ccc(F)cc6)C(=O)C45)C23)ccc1OCC(=O)Nc1ccccc1C(F)(F)F |
| InChI | InChI=1S/C35H27F4N3O6S2/c1-47-23-12-15(6-11-22(23)48-14-24(43)40-21-5-3-2-4-20(21)35(37,38)39)25-26-18-13-19(29(26)49-31-30(25)50-34(46)41-31)28-27(18)32(44)42(33(28)45)17-9-7-16(36)8-10-17/h2-12,18-19,25-29H,13-14H2,1H3,(H,40,43)(H,41,46) |
| InChIKey | KZWLZARSLMQTKC-UHFFFAOYSA-N |
| XLogP | 6.30 |
| TPSA | 117.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 725.74 |
| LogP ≤ 5 | 6.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'thiaz_ene_E(8)', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|