C29H19ClF3N3O6S2 — CID 78580180
2-[4-chloro-2-[(8S)-5,10,12-trioxo-11-[2-(trifluoromethyl)phenyl]-2,6-dithia-4,11-diazatricyclo[7.3.0.03,7]dodec-3(7)-en-8-yl]phenoxy]-N-(4-hydroxyphenyl)acetamide (PubChem CID 78580180) has the molecular formula C29H19ClF3N3O6S2 and a molecular weight of 662.07 g/mol. Its IUPAC name is 2-[4-chloro-2-[(8S)-5,10,12-trioxo-11-[2-(trifluoromethyl)phenyl]-2,6-dithia-4,11-diazatricyclo[7.3.0.03,7]dodec-3(7)-en-8-yl]phenoxy]-N-(4-hydroxyphenyl)acetamide.
| Compound Name | 2-[4-chloro-2-[(8S)-5,10,12-trioxo-11-[2-(trifluoromethyl)phenyl]-2,6-dithia-4,11-diazatricyclo[7.3.0.03,7]dodec-3(7)-en-8-yl]phenoxy]-N-(4-hydroxyphenyl)acetamide |
|---|---|
| PubChem CID | 78580180 |
| Molecular Formula | C29H19ClF3N3O6S2 |
| Molecular Weight | 662.07 g/mol |
| Exact Mass | 661.04 |
| IUPAC Name | 2-[4-chloro-2-[(8S)-5,10,12-trioxo-11-[2-(trifluoromethyl)phenyl]-2,6-dithia-4,11-diazatricyclo[7.3.0.03,7]dodec-3(7)-en-8-yl]phenoxy]-N-(4-hydroxyphenyl)acetamide |
| SMILES | O=C(COc1ccc(Cl)cc1[C@H]1c2sc(=O)[nH]c2SC2C(=O)N(c3ccccc3C(F)(F)F)C(=O)C21)Nc1ccc(O)cc1 |
| InChI | InChI=1S/C29H19ClF3N3O6S2/c30-13-5-10-19(42-12-20(38)34-14-6-8-15(37)9-7-14)16(11-13)21-22-24(43-25-23(21)44-28(41)35-25)27(40)36(26(22)39)18-4-2-1-3-17(18)29(31,32)33/h1-11,21-22,24,37H,12H2,(H,34,38)(H,35,41)/t21-,22?,24?/m1/s1 |
| InChIKey | CKRFZUPXGLOGIB-ZLHNRXBCSA-N |
| XLogP | 5.63 |
| TPSA | 128.80 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 662.07 |
| LogP ≤ 5 | 5.63 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'thiaz_ene_E(8)', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|