C18H21N7O3 — CID 7858115
1-[[4-amino-6-(2-methylanilino)-1,3,5-triazin-2-yl]methyl]-3-(2-methylpropyl)imidazolidine-2,4,5-trione (PubChem CID 7858115) has the molecular formula C18H21N7O3 and a molecular weight of 383.41 g/mol. Its IUPAC name is 1-[[4-amino-6-(2-methylanilino)-1,3,5-triazin-2-yl]methyl]-3-(2-methylpropyl)imidazolidine-2,4,5-trione.
| Compound Name | 1-[[4-amino-6-(2-methylanilino)-1,3,5-triazin-2-yl]methyl]-3-(2-methylpropyl)imidazolidine-2,4,5-trione |
|---|---|
| PubChem CID | 7858115 |
| Molecular Formula | C18H21N7O3 |
| Molecular Weight | 383.41 g/mol |
| Exact Mass | 383.17 |
| IUPAC Name | 1-[[4-amino-6-(2-methylanilino)-1,3,5-triazin-2-yl]methyl]-3-(2-methylpropyl)imidazolidine-2,4,5-trione |
| SMILES | Cc1ccccc1Nc1nc(N)nc(CN2C(=O)C(=O)N(CC(C)C)C2=O)n1 |
| InChI | InChI=1S/C18H21N7O3/c1-10(2)8-24-14(26)15(27)25(18(24)28)9-13-21-16(19)23-17(22-13)20-12-7-5-4-6-11(12)3/h4-7,10H,8-9H2,1-3H3,(H3,19,20,21,22,23) |
| InChIKey | UWFQZYCINUREKA-UHFFFAOYSA-N |
| XLogP | 1.45 |
| TPSA | 134.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.41 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|