C23H23N7O2 — CID 26918700
(4R)-3'-[[4-amino-6-(2-methylanilino)-1,3,5-triazin-2-yl]methyl]spiro[2,3-dihydro-1H-naphthalene-4,5'-imidazolidine]-2',4'-dione (PubChem CID 26918700) has the molecular formula C23H23N7O2 and a molecular weight of 429.48 g/mol. Its IUPAC name is (4R)-3'-[[4-amino-6-(2-methylanilino)-1,3,5-triazin-2-yl]methyl]spiro[2,3-dihydro-1H-naphthalene-4,5'-imidazolidine]-2',4'-dione.
| Compound Name | (4R)-3'-[[4-amino-6-(2-methylanilino)-1,3,5-triazin-2-yl]methyl]spiro[2,3-dihydro-1H-naphthalene-4,5'-imidazolidine]-2',4'-dione |
|---|---|
| PubChem CID | 26918700 |
| Molecular Formula | C23H23N7O2 |
| Molecular Weight | 429.48 g/mol |
| Exact Mass | 429.19 |
| IUPAC Name | (4R)-3'-[[4-amino-6-(2-methylanilino)-1,3,5-triazin-2-yl]methyl]spiro[2,3-dihydro-1H-naphthalene-4,5'-imidazolidine]-2',4'-dione |
| SMILES | Cc1ccccc1Nc1nc(N)nc(CN2C(=O)N[C@@]3(CCCc4ccccc43)C2=O)n1 |
| InChI | InChI=1S/C23H23N7O2/c1-14-7-2-5-11-17(14)25-21-27-18(26-20(24)28-21)13-30-19(31)23(29-22(30)32)12-6-9-15-8-3-4-10-16(15)23/h2-5,7-8,10-11H,6,9,12-13H2,1H3,(H,29,32)(H3,24,25,26,27,28)/t23-/m1/s1 |
| InChIKey | OPWRJCUFWLOHBF-HSZRJFAPSA-N |
| XLogP | 2.79 |
| TPSA | 126.13 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.48 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|