C21H21N7O2S — CID 41208236
(4S)-3'-[[4-amino-6-(4-methylanilino)-1,3,5-triazin-2-yl]methyl]spiro[6,7-dihydro-5H-1-benzothiophene-4,5'-imidazolidine]-2',4'-dione (PubChem CID 41208236) has the molecular formula C21H21N7O2S and a molecular weight of 435.51 g/mol. Its IUPAC name is (4S)-3'-[[4-amino-6-(4-methylanilino)-1,3,5-triazin-2-yl]methyl]spiro[6,7-dihydro-5H-1-benzothiophene-4,5'-imidazolidine]-2',4'-dione.
| Compound Name | (4S)-3'-[[4-amino-6-(4-methylanilino)-1,3,5-triazin-2-yl]methyl]spiro[6,7-dihydro-5H-1-benzothiophene-4,5'-imidazolidine]-2',4'-dione |
|---|---|
| PubChem CID | 41208236 |
| Molecular Formula | C21H21N7O2S |
| Molecular Weight | 435.51 g/mol |
| Exact Mass | 435.15 |
| IUPAC Name | (4S)-3'-[[4-amino-6-(4-methylanilino)-1,3,5-triazin-2-yl]methyl]spiro[6,7-dihydro-5H-1-benzothiophene-4,5'-imidazolidine]-2',4'-dione |
| SMILES | Cc1ccc(Nc2nc(N)nc(CN3C(=O)N[C@]4(CCCc5sccc54)C3=O)n2)cc1 |
| InChI | InChI=1S/C21H21N7O2S/c1-12-4-6-13(7-5-12)23-19-25-16(24-18(22)26-19)11-28-17(29)21(27-20(28)30)9-2-3-15-14(21)8-10-31-15/h4-8,10H,2-3,9,11H2,1H3,(H,27,30)(H3,22,23,24,25,26)/t21-/m0/s1 |
| InChIKey | SPSBFWKTWICITJ-NRFANRHFSA-N |
| XLogP | 2.85 |
| TPSA | 126.13 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.51 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|