C24H25N7O2 — CID 51544112
(4R)-3'-[[4-amino-6-(2-ethylanilino)-1,3,5-triazin-2-yl]methyl]spiro[2,3-dihydro-1H-naphthalene-4,5'-imidazolidine]-2',4'-dione (PubChem CID 51544112) has the molecular formula C24H25N7O2 and a molecular weight of 443.51 g/mol. Its IUPAC name is (4R)-3'-[[4-amino-6-(2-ethylanilino)-1,3,5-triazin-2-yl]methyl]spiro[2,3-dihydro-1H-naphthalene-4,5'-imidazolidine]-2',4'-dione.
| Compound Name | (4R)-3'-[[4-amino-6-(2-ethylanilino)-1,3,5-triazin-2-yl]methyl]spiro[2,3-dihydro-1H-naphthalene-4,5'-imidazolidine]-2',4'-dione |
|---|---|
| PubChem CID | 51544112 |
| Molecular Formula | C24H25N7O2 |
| Molecular Weight | 443.51 g/mol |
| Exact Mass | 443.21 |
| IUPAC Name | (4R)-3'-[[4-amino-6-(2-ethylanilino)-1,3,5-triazin-2-yl]methyl]spiro[2,3-dihydro-1H-naphthalene-4,5'-imidazolidine]-2',4'-dione |
| SMILES | CCc1ccccc1Nc1nc(N)nc(CN2C(=O)N[C@@]3(CCCc4ccccc43)C2=O)n1 |
| InChI | InChI=1S/C24H25N7O2/c1-2-15-8-4-6-12-18(15)26-22-28-19(27-21(25)29-22)14-31-20(32)24(30-23(31)33)13-7-10-16-9-3-5-11-17(16)24/h3-6,8-9,11-12H,2,7,10,13-14H2,1H3,(H,30,33)(H3,25,26,27,28,29)/t24-/m1/s1 |
| InChIKey | ODHRRPDNFMWUKT-XMMPIXPASA-N |
| XLogP | 3.04 |
| TPSA | 126.13 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.51 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|