C22H21N7O2 — CID 25331951
(3R)-3'-[[4-amino-6-(4-methylanilino)-1,3,5-triazin-2-yl]methyl]spiro[1,2-dihydroindene-3,5'-imidazolidine]-2',4'-dione (PubChem CID 25331951) has the molecular formula C22H21N7O2 and a molecular weight of 415.46 g/mol. Its IUPAC name is (3R)-3'-[[4-amino-6-(4-methylanilino)-1,3,5-triazin-2-yl]methyl]spiro[1,2-dihydroindene-3,5'-imidazolidine]-2',4'-dione.
| Compound Name | (3R)-3'-[[4-amino-6-(4-methylanilino)-1,3,5-triazin-2-yl]methyl]spiro[1,2-dihydroindene-3,5'-imidazolidine]-2',4'-dione |
|---|---|
| PubChem CID | 25331951 |
| Molecular Formula | C22H21N7O2 |
| Molecular Weight | 415.46 g/mol |
| Exact Mass | 415.18 |
| IUPAC Name | (3R)-3'-[[4-amino-6-(4-methylanilino)-1,3,5-triazin-2-yl]methyl]spiro[1,2-dihydroindene-3,5'-imidazolidine]-2',4'-dione |
| SMILES | Cc1ccc(Nc2nc(N)nc(CN3C(=O)N[C@@]4(CCc5ccccc54)C3=O)n2)cc1 |
| InChI | InChI=1S/C22H21N7O2/c1-13-6-8-15(9-7-13)24-20-26-17(25-19(23)27-20)12-29-18(30)22(28-21(29)31)11-10-14-4-2-3-5-16(14)22/h2-9H,10-12H2,1H3,(H,28,31)(H3,23,24,25,26,27)/t22-/m1/s1 |
| InChIKey | MOISMZPWEHTVAU-JOCHJYFZSA-N |
| XLogP | 2.40 |
| TPSA | 126.13 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.46 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|