C19H22FN7O2 — CID 9451386
(5S,6S)-3-[[4-amino-6-(4-fluoroanilino)-1,3,5-triazin-2-yl]methyl]-6-methyl-1,3-diazaspiro[4.5]decane-2,4-dione (PubChem CID 9451386) has the molecular formula C19H22FN7O2 and a molecular weight of 399.43 g/mol. Its IUPAC name is (5S,6S)-3-[[4-amino-6-(4-fluoroanilino)-1,3,5-triazin-2-yl]methyl]-6-methyl-1,3-diazaspiro[4.5]decane-2,4-dione.
| Compound Name | (5S,6S)-3-[[4-amino-6-(4-fluoroanilino)-1,3,5-triazin-2-yl]methyl]-6-methyl-1,3-diazaspiro[4.5]decane-2,4-dione |
|---|---|
| PubChem CID | 9451386 |
| Molecular Formula | C19H22FN7O2 |
| Molecular Weight | 399.43 g/mol |
| Exact Mass | 399.18 |
| IUPAC Name | (5S,6S)-3-[[4-amino-6-(4-fluoroanilino)-1,3,5-triazin-2-yl]methyl]-6-methyl-1,3-diazaspiro[4.5]decane-2,4-dione |
| SMILES | C[C@H]1CCCC[C@]12NC(=O)N(Cc1nc(N)nc(Nc3ccc(F)cc3)n1)C2=O |
| InChI | InChI=1S/C19H22FN7O2/c1-11-4-2-3-9-19(11)15(28)27(18(29)26-19)10-14-23-16(21)25-17(24-14)22-13-7-5-12(20)6-8-13/h5-8,11H,2-4,9-10H2,1H3,(H,26,29)(H3,21,22,23,24,25)/t11-,19-/m0/s1 |
| InChIKey | HBTRSGVSWDRQMW-WLRWDXFRSA-N |
| XLogP | 2.34 |
| TPSA | 126.13 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.43 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|