C17H24FN7 — CID 167847537
6-[(2,6-dimethyl-1,4-diazepan-1-yl)methyl]-2-N-(4-fluorophenyl)-1,3,5-triazine-2,4-diamine (PubChem CID 167847537) has the molecular formula C17H24FN7 and a molecular weight of 345.43 g/mol. Its IUPAC name is 6-[(2,6-dimethyl-1,4-diazepan-1-yl)methyl]-2-N-(4-fluorophenyl)-1,3,5-triazine-2,4-diamine.
| Compound Name | 6-[(2,6-dimethyl-1,4-diazepan-1-yl)methyl]-2-N-(4-fluorophenyl)-1,3,5-triazine-2,4-diamine |
|---|---|
| PubChem CID | 167847537 |
| Molecular Formula | C17H24FN7 |
| Molecular Weight | 345.43 g/mol |
| Exact Mass | 345.21 |
| IUPAC Name | 6-[(2,6-dimethyl-1,4-diazepan-1-yl)methyl]-2-N-(4-fluorophenyl)-1,3,5-triazine-2,4-diamine |
| SMILES | CC1CNCC(C)N(Cc2nc(N)nc(Nc3ccc(F)cc3)n2)C1 |
| InChI | InChI=1S/C17H24FN7/c1-11-7-20-8-12(2)25(9-11)10-15-22-16(19)24-17(23-15)21-14-5-3-13(18)4-6-14/h3-6,11-12,20H,7-10H2,1-2H3,(H3,19,21,22,23,24) |
| InChIKey | USJXAWSDLZUTAE-UHFFFAOYSA-N |
| XLogP | 1.77 |
| TPSA | 91.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.43 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |