C22H20FN7O4 — CID 40799359
(5R)-3-[[4-amino-6-(4-fluoroanilino)-1,3,5-triazin-2-yl]methyl]-5-(2,3-dihydro-1,4-benzodioxin-6-yl)-5-methylimidazolidine-2,4-dione (PubChem CID 40799359) has the molecular formula C22H20FN7O4 and a molecular weight of 465.45 g/mol. Its IUPAC name is (5R)-3-[[4-amino-6-(4-fluoroanilino)-1,3,5-triazin-2-yl]methyl]-5-(2,3-dihydro-1,4-benzodioxin-6-yl)-5-methylimidazolidine-2,4-dione.
| Compound Name | (5R)-3-[[4-amino-6-(4-fluoroanilino)-1,3,5-triazin-2-yl]methyl]-5-(2,3-dihydro-1,4-benzodioxin-6-yl)-5-methylimidazolidine-2,4-dione |
|---|---|
| PubChem CID | 40799359 |
| Molecular Formula | C22H20FN7O4 |
| Molecular Weight | 465.45 g/mol |
| Exact Mass | 465.16 |
| IUPAC Name | (5R)-3-[[4-amino-6-(4-fluoroanilino)-1,3,5-triazin-2-yl]methyl]-5-(2,3-dihydro-1,4-benzodioxin-6-yl)-5-methylimidazolidine-2,4-dione |
| SMILES | C[C@]1(c2ccc3c(c2)OCCO3)NC(=O)N(Cc2nc(N)nc(Nc3ccc(F)cc3)n2)C1=O |
| InChI | InChI=1S/C22H20FN7O4/c1-22(12-2-7-15-16(10-12)34-9-8-33-15)18(31)30(21(32)29-22)11-17-26-19(24)28-20(27-17)25-14-5-3-13(23)4-6-14/h2-7,10H,8-9,11H2,1H3,(H,29,32)(H3,24,25,26,27,28)/t22-/m1/s1 |
| InChIKey | FFLSUPXDROEPDO-JOCHJYFZSA-N |
| XLogP | 2.07 |
| TPSA | 144.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.45 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|