C15H23N7O2 — CID 27068137
(5R,6R)-3-[[4-amino-6-(dimethylamino)-1,3,5-triazin-2-yl]methyl]-6-methyl-1,3-diazaspiro[4.5]decane-2,4-dione (PubChem CID 27068137) has the molecular formula C15H23N7O2 and a molecular weight of 333.40 g/mol. Its IUPAC name is (5R,6R)-3-[[4-amino-6-(dimethylamino)-1,3,5-triazin-2-yl]methyl]-6-methyl-1,3-diazaspiro[4.5]decane-2,4-dione.
| Compound Name | (5R,6R)-3-[[4-amino-6-(dimethylamino)-1,3,5-triazin-2-yl]methyl]-6-methyl-1,3-diazaspiro[4.5]decane-2,4-dione |
|---|---|
| PubChem CID | 27068137 |
| Molecular Formula | C15H23N7O2 |
| Molecular Weight | 333.40 g/mol |
| Exact Mass | 333.19 |
| IUPAC Name | (5R,6R)-3-[[4-amino-6-(dimethylamino)-1,3,5-triazin-2-yl]methyl]-6-methyl-1,3-diazaspiro[4.5]decane-2,4-dione |
| SMILES | C[C@@H]1CCCC[C@@]12NC(=O)N(Cc1nc(N)nc(N(C)C)n1)C2=O |
| InChI | InChI=1S/C15H23N7O2/c1-9-6-4-5-7-15(9)11(23)22(14(24)20-15)8-10-17-12(16)19-13(18-10)21(2)3/h9H,4-8H2,1-3H3,(H,20,24)(H2,16,17,18,19)/t9-,15-/m1/s1 |
| InChIKey | RGKUUOGXIVQFNH-RFAUZJTJSA-N |
| XLogP | 0.52 |
| TPSA | 117.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.40 |
| LogP ≤ 5 | 0.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|