C22H24N2O5 — CID 7860595
[(2S)-1-oxo-1-[[(2S)-4-phenylbutan-2-yl]amino]propan-2-yl] (E)-3-(4-nitrophenyl)prop-2-enoate (PubChem CID 7860595) has the molecular formula C22H24N2O5 and a molecular weight of 396.44 g/mol. Its IUPAC name is [(2S)-1-oxo-1-[[(2S)-4-phenylbutan-2-yl]amino]propan-2-yl] (E)-3-(4-nitrophenyl)prop-2-enoate.
| Compound Name | [(2S)-1-oxo-1-[[(2S)-4-phenylbutan-2-yl]amino]propan-2-yl] (E)-3-(4-nitrophenyl)prop-2-enoate |
|---|---|
| PubChem CID | 7860595 |
| Molecular Formula | C22H24N2O5 |
| Molecular Weight | 396.44 g/mol |
| Exact Mass | 396.17 |
| IUPAC Name | [(2S)-1-oxo-1-[[(2S)-4-phenylbutan-2-yl]amino]propan-2-yl] (E)-3-(4-nitrophenyl)prop-2-enoate |
| SMILES | C[C@H](OC(=O)/C=C/c1ccc([N+](=O)[O-])cc1)C(=O)N[C@@H](C)CCc1ccccc1 |
| InChI | InChI=1S/C22H24N2O5/c1-16(8-9-18-6-4-3-5-7-18)23-22(26)17(2)29-21(25)15-12-19-10-13-20(14-11-19)24(27)28/h3-7,10-17H,8-9H2,1-2H3,(H,23,26)/b15-12+/t16-,17-/m0/s1 |
| InChIKey | YPVSLZJAUYTUEI-LHGWUTHLSA-N |
| XLogP | 3.68 |
| TPSA | 98.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.44 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|