C16H10N2O6 — CID 786265
(4-nitrophenyl) 2-(1,3-dioxoisoindol-2-yl)acetate (PubChem CID 786265) has the molecular formula C16H10N2O6 and a molecular weight of 326.26 g/mol. Its IUPAC name is (4-nitrophenyl) 2-(1,3-dioxoisoindol-2-yl)acetate.
| Compound Name | (4-nitrophenyl) 2-(1,3-dioxoisoindol-2-yl)acetate |
|---|---|
| PubChem CID | 786265 |
| Molecular Formula | C16H10N2O6 |
| Molecular Weight | 326.26 g/mol |
| Exact Mass | 326.05 |
| IUPAC Name | (4-nitrophenyl) 2-(1,3-dioxoisoindol-2-yl)acetate |
| SMILES | O=C(CN1C(=O)c2ccccc2C1=O)Oc1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C16H10N2O6/c19-14(24-11-7-5-10(6-8-11)18(22)23)9-17-15(20)12-3-1-2-4-13(12)16(17)21/h1-8H,9H2 |
| InChIKey | FSCDNNJLCIKUHL-UHFFFAOYSA-N |
| XLogP | 1.80 |
| TPSA | 106.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.26 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|