C20H12N2O8 — CID 1247393
(4-methyl-2-oxochromen-6-yl) 2-(4-nitro-1,3-dioxoisoindol-2-yl)acetate (PubChem CID 1247393) has the molecular formula C20H12N2O8 and a molecular weight of 408.32 g/mol. Its IUPAC name is (4-methyl-2-oxochromen-6-yl) 2-(4-nitro-1,3-dioxoisoindol-2-yl)acetate.
| Compound Name | (4-methyl-2-oxochromen-6-yl) 2-(4-nitro-1,3-dioxoisoindol-2-yl)acetate |
|---|---|
| PubChem CID | 1247393 |
| Molecular Formula | C20H12N2O8 |
| Molecular Weight | 408.32 g/mol |
| Exact Mass | 408.06 |
| IUPAC Name | (4-methyl-2-oxochromen-6-yl) 2-(4-nitro-1,3-dioxoisoindol-2-yl)acetate |
| SMILES | Cc1cc(=O)oc2ccc(OC(=O)CN3C(=O)c4cccc([N+](=O)[O-])c4C3=O)cc12 |
| InChI | InChI=1S/C20H12N2O8/c1-10-7-16(23)30-15-6-5-11(8-13(10)15)29-17(24)9-21-19(25)12-3-2-4-14(22(27)28)18(12)20(21)26/h2-8H,9H2,1H3 |
| InChIKey | HYOAJBBEDIIISN-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 137.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.32 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|