C22H18F3N3O5 — CID 151185053
2,2,2-trifluoro-N-[2,2,5-trimethyl-6-nitro-4-(3-oxo-1H-isoindol-2-yl)chromen-3-yl]acetamide (PubChem CID 151185053) has the molecular formula C22H18F3N3O5 and a molecular weight of 461.40 g/mol. Its IUPAC name is 2,2,2-trifluoro-N-[2,2,5-trimethyl-6-nitro-4-(3-oxo-1H-isoindol-2-yl)chromen-3-yl]acetamide.
| Compound Name | 2,2,2-trifluoro-N-[2,2,5-trimethyl-6-nitro-4-(3-oxo-1H-isoindol-2-yl)chromen-3-yl]acetamide |
|---|---|
| PubChem CID | 151185053 |
| Molecular Formula | C22H18F3N3O5 |
| Molecular Weight | 461.40 g/mol |
| Exact Mass | 461.12 |
| IUPAC Name | 2,2,2-trifluoro-N-[2,2,5-trimethyl-6-nitro-4-(3-oxo-1H-isoindol-2-yl)chromen-3-yl]acetamide |
| SMILES | Cc1c([N+](=O)[O-])ccc2c1C(N1Cc3ccccc3C1=O)=C(NC(=O)C(F)(F)F)C(C)(C)O2 |
| InChI | InChI=1S/C22H18F3N3O5/c1-11-14(28(31)32)8-9-15-16(11)17(27-10-12-6-4-5-7-13(12)19(27)29)18(21(2,3)33-15)26-20(30)22(23,24)25/h4-9H,10H2,1-3H3,(H,26,30) |
| InChIKey | NFCMUVPQAWKKHS-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 101.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.40 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|