C24H19FN2O6 — CID 135157071
methyl 2-(5-fluoro-2-phenylmethoxyphenyl)-2-(4-nitro-3-oxo-1H-isoindol-2-yl)acetate (PubChem CID 135157071) has the molecular formula C24H19FN2O6 and a molecular weight of 450.42 g/mol. Its IUPAC name is methyl 2-(5-fluoro-2-phenylmethoxyphenyl)-2-(4-nitro-3-oxo-1H-isoindol-2-yl)acetate.
| Compound Name | methyl 2-(5-fluoro-2-phenylmethoxyphenyl)-2-(4-nitro-3-oxo-1H-isoindol-2-yl)acetate |
|---|---|
| PubChem CID | 135157071 |
| Molecular Formula | C24H19FN2O6 |
| Molecular Weight | 450.42 g/mol |
| Exact Mass | 450.12 |
| IUPAC Name | methyl 2-(5-fluoro-2-phenylmethoxyphenyl)-2-(4-nitro-3-oxo-1H-isoindol-2-yl)acetate |
| SMILES | COC(=O)C(c1cc(F)ccc1OCc1ccccc1)N1Cc2cccc([N+](=O)[O-])c2C1=O |
| InChI | InChI=1S/C24H19FN2O6/c1-32-24(29)22(26-13-16-8-5-9-19(27(30)31)21(16)23(26)28)18-12-17(25)10-11-20(18)33-14-15-6-3-2-4-7-15/h2-12,22H,13-14H2,1H3 |
| InChIKey | MGCDPIBLLLWTQM-UHFFFAOYSA-N |
| XLogP | 4.18 |
| TPSA | 98.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.42 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|