C19H20N2O5 — CID 7864378
[2-[[(1R)-1-(4-methylphenyl)propyl]amino]-2-oxoethyl] 2-nitrobenzoate (PubChem CID 7864378) has the molecular formula C19H20N2O5 and a molecular weight of 356.38 g/mol. Its IUPAC name is [2-[[(1R)-1-(4-methylphenyl)propyl]amino]-2-oxoethyl] 2-nitrobenzoate.
| Compound Name | [2-[[(1R)-1-(4-methylphenyl)propyl]amino]-2-oxoethyl] 2-nitrobenzoate |
|---|---|
| PubChem CID | 7864378 |
| Molecular Formula | C19H20N2O5 |
| Molecular Weight | 356.38 g/mol |
| Exact Mass | 356.14 |
| IUPAC Name | [2-[[(1R)-1-(4-methylphenyl)propyl]amino]-2-oxoethyl] 2-nitrobenzoate |
| SMILES | CC[C@@H](NC(=O)COC(=O)c1ccccc1[N+](=O)[O-])c1ccc(C)cc1 |
| InChI | InChI=1S/C19H20N2O5/c1-3-16(14-10-8-13(2)9-11-14)20-18(22)12-26-19(23)15-6-4-5-7-17(15)21(24)25/h4-11,16H,3,12H2,1-2H3,(H,20,22)/t16-/m1/s1 |
| InChIKey | XPEHDNAIHQQJGN-MRXNPFEDSA-N |
| XLogP | 3.33 |
| TPSA | 98.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.38 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|