C21H18Cl2N2O3 — CID 7867612
[2-[1-[(2-chlorophenyl)methyl]-2,5-dimethylpyrrol-3-yl]-2-oxoethyl] 2-chloropyridine-3-carboxylate (PubChem CID 7867612) has the molecular formula C21H18Cl2N2O3 and a molecular weight of 417.29 g/mol. Its IUPAC name is [2-[1-[(2-chlorophenyl)methyl]-2,5-dimethylpyrrol-3-yl]-2-oxoethyl] 2-chloropyridine-3-carboxylate.
| Compound Name | [2-[1-[(2-chlorophenyl)methyl]-2,5-dimethylpyrrol-3-yl]-2-oxoethyl] 2-chloropyridine-3-carboxylate |
|---|---|
| PubChem CID | 7867612 |
| Molecular Formula | C21H18Cl2N2O3 |
| Molecular Weight | 417.29 g/mol |
| Exact Mass | 416.07 |
| IUPAC Name | [2-[1-[(2-chlorophenyl)methyl]-2,5-dimethylpyrrol-3-yl]-2-oxoethyl] 2-chloropyridine-3-carboxylate |
| SMILES | Cc1cc(C(=O)COC(=O)c2cccnc2Cl)c(C)n1Cc1ccccc1Cl |
| InChI | InChI=1S/C21H18Cl2N2O3/c1-13-10-17(14(2)25(13)11-15-6-3-4-8-18(15)22)19(26)12-28-21(27)16-7-5-9-24-20(16)23/h3-10H,11-12H2,1-2H3 |
| InChIKey | OJSSPHDSOYZNHT-UHFFFAOYSA-N |
| XLogP | 4.89 |
| TPSA | 61.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.29 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|