C19H20N2O4 — CID 7874481
[2-[cyclohexen-1-yl(furan-2-ylmethyl)amino]-2-oxoethyl] pyridine-2-carboxylate (PubChem CID 7874481) has the molecular formula C19H20N2O4 and a molecular weight of 340.38 g/mol. Its IUPAC name is [2-[cyclohexen-1-yl(furan-2-ylmethyl)amino]-2-oxoethyl] pyridine-2-carboxylate.
| Compound Name | [2-[cyclohexen-1-yl(furan-2-ylmethyl)amino]-2-oxoethyl] pyridine-2-carboxylate |
|---|---|
| PubChem CID | 7874481 |
| Molecular Formula | C19H20N2O4 |
| Molecular Weight | 340.38 g/mol |
| Exact Mass | 340.14 |
| IUPAC Name | [2-[cyclohexen-1-yl(furan-2-ylmethyl)amino]-2-oxoethyl] pyridine-2-carboxylate |
| SMILES | O=C(OCC(=O)N(Cc1ccco1)C1=CCCCC1)c1ccccn1 |
| InChI | InChI=1S/C19H20N2O4/c22-18(14-25-19(23)17-10-4-5-11-20-17)21(13-16-9-6-12-24-16)15-7-2-1-3-8-15/h4-7,9-12H,1-3,8,13-14H2 |
| InChIKey | PCULAZABBJEVQA-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 72.64 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.38 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |