C22H22N2O5 — CID 7628919
[2-[cyclohexen-1-yl(furan-2-ylmethyl)amino]-2-oxoethyl] 2-(4-cyanophenoxy)acetate (PubChem CID 7628919) has the molecular formula C22H22N2O5 and a molecular weight of 394.43 g/mol. Its IUPAC name is [2-[cyclohexen-1-yl(furan-2-ylmethyl)amino]-2-oxoethyl] 2-(4-cyanophenoxy)acetate.
| Compound Name | [2-[cyclohexen-1-yl(furan-2-ylmethyl)amino]-2-oxoethyl] 2-(4-cyanophenoxy)acetate |
|---|---|
| PubChem CID | 7628919 |
| Molecular Formula | C22H22N2O5 |
| Molecular Weight | 394.43 g/mol |
| Exact Mass | 394.15 |
| IUPAC Name | [2-[cyclohexen-1-yl(furan-2-ylmethyl)amino]-2-oxoethyl] 2-(4-cyanophenoxy)acetate |
| SMILES | N#Cc1ccc(OCC(=O)OCC(=O)N(Cc2ccco2)C2=CCCCC2)cc1 |
| InChI | InChI=1S/C22H22N2O5/c23-13-17-8-10-19(11-9-17)28-16-22(26)29-15-21(25)24(14-20-7-4-12-27-20)18-5-2-1-3-6-18/h4-5,7-12H,1-3,6,14-16H2 |
| InChIKey | KEQUITLUCQNCSX-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 92.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.43 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |