C10H15F3N4O2S — CID 78759525
2-[[4-(3-methoxypropyl)-1,2,4-triazol-3-yl]sulfanyl]-N-(2,2,2-trifluoroethyl)acetamide (PubChem CID 78759525) has the molecular formula C10H15F3N4O2S and a molecular weight of 312.32 g/mol. Its IUPAC name is 2-[[4-(3-methoxypropyl)-1,2,4-triazol-3-yl]sulfanyl]-N-(2,2,2-trifluoroethyl)acetamide.
| Compound Name | 2-[[4-(3-methoxypropyl)-1,2,4-triazol-3-yl]sulfanyl]-N-(2,2,2-trifluoroethyl)acetamide |
|---|---|
| PubChem CID | 78759525 |
| Molecular Formula | C10H15F3N4O2S |
| Molecular Weight | 312.32 g/mol |
| Exact Mass | 312.09 |
| IUPAC Name | 2-[[4-(3-methoxypropyl)-1,2,4-triazol-3-yl]sulfanyl]-N-(2,2,2-trifluoroethyl)acetamide |
| SMILES | COCCCn1cnnc1SCC(=O)NCC(F)(F)F |
| InChI | InChI=1S/C10H15F3N4O2S/c1-19-4-2-3-17-7-15-16-9(17)20-5-8(18)14-6-10(11,12)13/h7H,2-6H2,1H3,(H,14,18) |
| InChIKey | MQHOVUJKBVJPQJ-UHFFFAOYSA-N |
| XLogP | 1.09 |
| TPSA | 69.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.32 |
| LogP ≤ 5 | 1.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|