C12H18F3N5O2S — CID 8957872
2-[(4-pentyl-1,2,4-triazol-3-yl)sulfanyl]-N-(2,2,2-trifluoroethylcarbamoyl)acetamide (PubChem CID 8957872) has the molecular formula C12H18F3N5O2S and a molecular weight of 353.37 g/mol. Its IUPAC name is 2-[(4-pentyl-1,2,4-triazol-3-yl)sulfanyl]-N-(2,2,2-trifluoroethylcarbamoyl)acetamide.
| Compound Name | 2-[(4-pentyl-1,2,4-triazol-3-yl)sulfanyl]-N-(2,2,2-trifluoroethylcarbamoyl)acetamide |
|---|---|
| PubChem CID | 8957872 |
| Molecular Formula | C12H18F3N5O2S |
| Molecular Weight | 353.37 g/mol |
| Exact Mass | 353.11 |
| IUPAC Name | 2-[(4-pentyl-1,2,4-triazol-3-yl)sulfanyl]-N-(2,2,2-trifluoroethylcarbamoyl)acetamide |
| SMILES | CCCCCn1cnnc1SCC(=O)NC(=O)NCC(F)(F)F |
| InChI | InChI=1S/C12H18F3N5O2S/c1-2-3-4-5-20-8-17-19-11(20)23-6-9(21)18-10(22)16-7-12(13,14)15/h8H,2-7H2,1H3,(H2,16,18,21,22) |
| InChIKey | SNMKGHZHVIVSCF-UHFFFAOYSA-N |
| XLogP | 1.95 |
| TPSA | 88.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.37 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|