C10H12F3N5O2S — CID 8739409
2-[(4-prop-2-enyl-1,2,4-triazol-3-yl)sulfanyl]-N-(2,2,2-trifluoroethylcarbamoyl)acetamide (PubChem CID 8739409) has the molecular formula C10H12F3N5O2S and a molecular weight of 323.30 g/mol. Its IUPAC name is 2-[(4-prop-2-enyl-1,2,4-triazol-3-yl)sulfanyl]-N-(2,2,2-trifluoroethylcarbamoyl)acetamide.
| Compound Name | 2-[(4-prop-2-enyl-1,2,4-triazol-3-yl)sulfanyl]-N-(2,2,2-trifluoroethylcarbamoyl)acetamide |
|---|---|
| PubChem CID | 8739409 |
| Molecular Formula | C10H12F3N5O2S |
| Molecular Weight | 323.30 g/mol |
| Exact Mass | 323.07 |
| IUPAC Name | 2-[(4-prop-2-enyl-1,2,4-triazol-3-yl)sulfanyl]-N-(2,2,2-trifluoroethylcarbamoyl)acetamide |
| SMILES | C=CCn1cnnc1SCC(=O)NC(=O)NCC(F)(F)F |
| InChI | InChI=1S/C10H12F3N5O2S/c1-2-3-18-6-15-17-9(18)21-4-7(19)16-8(20)14-5-10(11,12)13/h2,6H,1,3-5H2,(H2,14,16,19,20) |
| InChIKey | GSCQMHHUKDBNIZ-UHFFFAOYSA-N |
| XLogP | 0.94 |
| TPSA | 88.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.30 |
| LogP ≤ 5 | 0.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|