C19H19N3OS2 — CID 78763378
N,N-dimethyl-4-(7-thia-9,11-diazatricyclo[6.4.0.02,6]dodeca-1(8),2(6),9,11-tetraen-12-ylsulfanylmethyl)benzamide (PubChem CID 78763378) has the molecular formula C19H19N3OS2 and a molecular weight of 369.52 g/mol. Its IUPAC name is N,N-dimethyl-4-(7-thia-9,11-diazatricyclo[6.4.0.02,6]dodeca-1(8),2(6),9,11-tetraen-12-ylsulfanylmethyl)benzamide.
| Compound Name | N,N-dimethyl-4-(7-thia-9,11-diazatricyclo[6.4.0.02,6]dodeca-1(8),2(6),9,11-tetraen-12-ylsulfanylmethyl)benzamide |
|---|---|
| PubChem CID | 78763378 |
| Molecular Formula | C19H19N3OS2 |
| Molecular Weight | 369.52 g/mol |
| Exact Mass | 369.10 |
| IUPAC Name | N,N-dimethyl-4-(7-thia-9,11-diazatricyclo[6.4.0.02,6]dodeca-1(8),2(6),9,11-tetraen-12-ylsulfanylmethyl)benzamide |
| SMILES | CN(C)C(=O)c1ccc(CSc2ncnc3sc4c(c23)CCC4)cc1 |
| InChI | InChI=1S/C19H19N3OS2/c1-22(2)19(23)13-8-6-12(7-9-13)10-24-17-16-14-4-3-5-15(14)25-18(16)21-11-20-17/h6-9,11H,3-5,10H2,1-2H3 |
| InChIKey | FCQGWGGTZDQUBA-UHFFFAOYSA-N |
| XLogP | 4.17 |
| TPSA | 46.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.52 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |