C19H27NO3S — CID 78764482
methyl 1-[2-(4-tert-butylphenyl)sulfanylacetyl]piperidine-4-carboxylate (PubChem CID 78764482) has the molecular formula C19H27NO3S and a molecular weight of 349.50 g/mol. Its IUPAC name is methyl 1-[2-(4-tert-butylphenyl)sulfanylacetyl]piperidine-4-carboxylate.
| Compound Name | methyl 1-[2-(4-tert-butylphenyl)sulfanylacetyl]piperidine-4-carboxylate |
|---|---|
| PubChem CID | 78764482 |
| Molecular Formula | C19H27NO3S |
| Molecular Weight | 349.50 g/mol |
| Exact Mass | 349.17 |
| IUPAC Name | methyl 1-[2-(4-tert-butylphenyl)sulfanylacetyl]piperidine-4-carboxylate |
| SMILES | COC(=O)C1CCN(C(=O)CSc2ccc(C(C)(C)C)cc2)CC1 |
| InChI | InChI=1S/C19H27NO3S/c1-19(2,3)15-5-7-16(8-6-15)24-13-17(21)20-11-9-14(10-12-20)18(22)23-4/h5-8,14H,9-13H2,1-4H3 |
| InChIKey | QUWDZAXINUOFMF-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.50 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |