C14H15BrFNO2 — CID 78765407
2-(2-bromo-4-fluorophenoxy)-N,N-bis(prop-2-enyl)acetamide (PubChem CID 78765407) has the molecular formula C14H15BrFNO2 and a molecular weight of 328.18 g/mol. Its IUPAC name is 2-(2-bromo-4-fluorophenoxy)-N,N-bis(prop-2-enyl)acetamide.
| Compound Name | 2-(2-bromo-4-fluorophenoxy)-N,N-bis(prop-2-enyl)acetamide |
|---|---|
| PubChem CID | 78765407 |
| Molecular Formula | C14H15BrFNO2 |
| Molecular Weight | 328.18 g/mol |
| Exact Mass | 327.03 |
| IUPAC Name | 2-(2-bromo-4-fluorophenoxy)-N,N-bis(prop-2-enyl)acetamide |
| SMILES | C=CCN(CC=C)C(=O)COc1ccc(F)cc1Br |
| InChI | InChI=1S/C14H15BrFNO2/c1-3-7-17(8-4-2)14(18)10-19-13-6-5-11(16)9-12(13)15/h3-6,9H,1-2,7-8,10H2 |
| InChIKey | PWFFZNFSGKWYFZ-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.18 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|