C15H16BrNO4 — CID 103601808
2-[2-[bis(prop-2-enyl)amino]-2-oxoethoxy]-5-bromobenzoic acid (PubChem CID 103601808) has the molecular formula C15H16BrNO4 and a molecular weight of 354.20 g/mol. Its IUPAC name is 2-[2-[bis(prop-2-enyl)amino]-2-oxoethoxy]-5-bromobenzoic acid.
| Compound Name | 2-[2-[bis(prop-2-enyl)amino]-2-oxoethoxy]-5-bromobenzoic acid |
|---|---|
| PubChem CID | 103601808 |
| Molecular Formula | C15H16BrNO4 |
| Molecular Weight | 354.20 g/mol |
| Exact Mass | 353.03 |
| IUPAC Name | 2-[2-[bis(prop-2-enyl)amino]-2-oxoethoxy]-5-bromobenzoic acid |
| SMILES | C=CCN(CC=C)C(=O)COc1ccc(Br)cc1C(=O)O |
| InChI | InChI=1S/C15H16BrNO4/c1-3-7-17(8-4-2)14(18)10-21-13-6-5-11(16)9-12(13)15(19)20/h3-6,9H,1-2,7-8,10H2,(H,19,20) |
| InChIKey | RZKNPBVJHICTKG-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 66.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.20 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|