C16H26N2OS2 — CID 78765721
[2-[1-(2-bicyclo[2.2.1]heptanyl)ethylamino]-2-oxoethyl] pyrrolidine-1-carbodithioate (PubChem CID 78765721) has the molecular formula C16H26N2OS2 and a molecular weight of 326.53 g/mol. Its IUPAC name is [2-[1-(2-bicyclo[2.2.1]heptanyl)ethylamino]-2-oxoethyl] pyrrolidine-1-carbodithioate.
| Compound Name | [2-[1-(2-bicyclo[2.2.1]heptanyl)ethylamino]-2-oxoethyl] pyrrolidine-1-carbodithioate |
|---|---|
| PubChem CID | 78765721 |
| Molecular Formula | C16H26N2OS2 |
| Molecular Weight | 326.53 g/mol |
| Exact Mass | 326.15 |
| IUPAC Name | [2-[1-(2-bicyclo[2.2.1]heptanyl)ethylamino]-2-oxoethyl] pyrrolidine-1-carbodithioate |
| SMILES | CC(NC(=O)CSC(=S)N1CCCC1)C1CC2CCC1C2 |
| InChI | InChI=1S/C16H26N2OS2/c1-11(14-9-12-4-5-13(14)8-12)17-15(19)10-21-16(20)18-6-2-3-7-18/h11-14H,2-10H2,1H3,(H,17,19) |
| InChIKey | IGLUEMDZTPRHPL-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.53 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|