C14H14F2N2O3 — CID 78767083
1-[2-(difluoromethoxy)phenyl]-N-[(3,5-dimethyl-1,2-oxazol-4-yl)methoxy]methanimine (PubChem CID 78767083) has the molecular formula C14H14F2N2O3 and a molecular weight of 296.27 g/mol. Its IUPAC name is 1-[2-(difluoromethoxy)phenyl]-N-[(3,5-dimethyl-1,2-oxazol-4-yl)methoxy]methanimine.
| Compound Name | 1-[2-(difluoromethoxy)phenyl]-N-[(3,5-dimethyl-1,2-oxazol-4-yl)methoxy]methanimine |
|---|---|
| PubChem CID | 78767083 |
| Molecular Formula | C14H14F2N2O3 |
| Molecular Weight | 296.27 g/mol |
| Exact Mass | 296.10 |
| IUPAC Name | 1-[2-(difluoromethoxy)phenyl]-N-[(3,5-dimethyl-1,2-oxazol-4-yl)methoxy]methanimine |
| SMILES | Cc1noc(C)c1CON=Cc1ccccc1OC(F)F |
| InChI | InChI=1S/C14H14F2N2O3/c1-9-12(10(2)21-18-9)8-19-17-7-11-5-3-4-6-13(11)20-14(15)16/h3-7,14H,8H2,1-2H3 |
| InChIKey | ULLJXYUUKHLOTC-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 56.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.27 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|