C20H24N2O4 — CID 78770585
(3-methylcyclohexyl) 2-(2',5'-dioxospiro[1,2-dihydroindene-3,4'-imidazolidine]-1'-yl)acetate (PubChem CID 78770585) has the molecular formula C20H24N2O4 and a molecular weight of 356.42 g/mol. Its IUPAC name is (3-methylcyclohexyl) 2-(2',5'-dioxospiro[1,2-dihydroindene-3,4'-imidazolidine]-1'-yl)acetate.
| Compound Name | (3-methylcyclohexyl) 2-(2',5'-dioxospiro[1,2-dihydroindene-3,4'-imidazolidine]-1'-yl)acetate |
|---|---|
| PubChem CID | 78770585 |
| Molecular Formula | C20H24N2O4 |
| Molecular Weight | 356.42 g/mol |
| Exact Mass | 356.17 |
| IUPAC Name | (3-methylcyclohexyl) 2-(2',5'-dioxospiro[1,2-dihydroindene-3,4'-imidazolidine]-1'-yl)acetate |
| SMILES | CC1CCCC(OC(=O)CN2C(=O)NC3(CCc4ccccc43)C2=O)C1 |
| InChI | InChI=1S/C20H24N2O4/c1-13-5-4-7-15(11-13)26-17(23)12-22-18(24)20(21-19(22)25)10-9-14-6-2-3-8-16(14)20/h2-3,6,8,13,15H,4-5,7,9-12H2,1H3,(H,21,25) |
| InChIKey | CUPCHBHCUCUELE-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.42 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|