C15H13Cl2N3O3 — CID 78771863
6-chloro-N'-[2-(4-chloro-2-methylphenoxy)acetyl]pyridine-3-carbohydrazide (PubChem CID 78771863) has the molecular formula C15H13Cl2N3O3 and a molecular weight of 354.19 g/mol. Its IUPAC name is 6-chloro-N'-[2-(4-chloro-2-methylphenoxy)acetyl]pyridine-3-carbohydrazide.
| Compound Name | 6-chloro-N'-[2-(4-chloro-2-methylphenoxy)acetyl]pyridine-3-carbohydrazide |
|---|---|
| PubChem CID | 78771863 |
| Molecular Formula | C15H13Cl2N3O3 |
| Molecular Weight | 354.19 g/mol |
| Exact Mass | 353.03 |
| IUPAC Name | 6-chloro-N'-[2-(4-chloro-2-methylphenoxy)acetyl]pyridine-3-carbohydrazide |
| SMILES | Cc1cc(Cl)ccc1OCC(=O)NNC(=O)c1ccc(Cl)nc1 |
| InChI | InChI=1S/C15H13Cl2N3O3/c1-9-6-11(16)3-4-12(9)23-8-14(21)19-20-15(22)10-2-5-13(17)18-7-10/h2-7H,8H2,1H3,(H,19,21)(H,20,22) |
| InChIKey | PHXTZXGIJDWTGE-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 80.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.19 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|