C17H21NO4 — CID 78780948
cyclohex-3-en-1-ylmethyl 1-(furan-2-ylmethyl)-5-oxopyrrolidine-3-carboxylate (PubChem CID 78780948) has the molecular formula C17H21NO4 and a molecular weight of 303.36 g/mol. Its IUPAC name is cyclohex-3-en-1-ylmethyl 1-(furan-2-ylmethyl)-5-oxopyrrolidine-3-carboxylate.
| Compound Name | cyclohex-3-en-1-ylmethyl 1-(furan-2-ylmethyl)-5-oxopyrrolidine-3-carboxylate |
|---|---|
| PubChem CID | 78780948 |
| Molecular Formula | C17H21NO4 |
| Molecular Weight | 303.36 g/mol |
| Exact Mass | 303.15 |
| IUPAC Name | cyclohex-3-en-1-ylmethyl 1-(furan-2-ylmethyl)-5-oxopyrrolidine-3-carboxylate |
| SMILES | O=C(OCC1CC=CCC1)C1CC(=O)N(Cc2ccco2)C1 |
| InChI | InChI=1S/C17H21NO4/c19-16-9-14(10-18(16)11-15-7-4-8-21-15)17(20)22-12-13-5-2-1-3-6-13/h1-2,4,7-8,13-14H,3,5-6,9-12H2 |
| InChIKey | IOZIOUNGVAZQTJ-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 59.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.36 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|