C13H15N3O — CID 787843
(E)-2-cyano-N-cyclopropyl-3-(2,5-dimethyl-1H-pyrrol-3-yl)prop-2-enamide (PubChem CID 787843) has the molecular formula C13H15N3O and a molecular weight of 229.28 g/mol. Its IUPAC name is (E)-2-cyano-N-cyclopropyl-3-(2,5-dimethyl-1H-pyrrol-3-yl)prop-2-enamide.
| Compound Name | (E)-2-cyano-N-cyclopropyl-3-(2,5-dimethyl-1H-pyrrol-3-yl)prop-2-enamide |
|---|---|
| PubChem CID | 787843 |
| Molecular Formula | C13H15N3O |
| Molecular Weight | 229.28 g/mol |
| Exact Mass | 229.12 |
| IUPAC Name | (E)-2-cyano-N-cyclopropyl-3-(2,5-dimethyl-1H-pyrrol-3-yl)prop-2-enamide |
| SMILES | Cc1cc(/C=C(\C#N)C(=O)NC2CC2)c(C)[nH]1 |
| InChI | InChI=1S/C13H15N3O/c1-8-5-10(9(2)15-8)6-11(7-14)13(17)16-12-3-4-12/h5-6,12,15H,3-4H2,1-2H3,(H,16,17)/b11-6+ |
| InChIKey | COIHLOLDPOGTGE-IZZDOVSWSA-N |
| XLogP | 1.82 |
| TPSA | 68.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.28 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|