C16H14FN3O — CID 787855
(E)-2-cyano-3-(2,5-dimethyl-1H-pyrrol-3-yl)-N-(2-fluorophenyl)prop-2-enamide (PubChem CID 787855) has the molecular formula C16H14FN3O and a molecular weight of 283.31 g/mol. Its IUPAC name is (E)-2-cyano-3-(2,5-dimethyl-1H-pyrrol-3-yl)-N-(2-fluorophenyl)prop-2-enamide.
| Compound Name | (E)-2-cyano-3-(2,5-dimethyl-1H-pyrrol-3-yl)-N-(2-fluorophenyl)prop-2-enamide |
|---|---|
| PubChem CID | 787855 |
| Molecular Formula | C16H14FN3O |
| Molecular Weight | 283.31 g/mol |
| Exact Mass | 283.11 |
| IUPAC Name | (E)-2-cyano-3-(2,5-dimethyl-1H-pyrrol-3-yl)-N-(2-fluorophenyl)prop-2-enamide |
| SMILES | Cc1cc(/C=C(\C#N)C(=O)Nc2ccccc2F)c(C)[nH]1 |
| InChI | InChI=1S/C16H14FN3O/c1-10-7-12(11(2)19-10)8-13(9-18)16(21)20-15-6-4-3-5-14(15)17/h3-8,19H,1-2H3,(H,20,21)/b13-8+ |
| InChIKey | LBGROOQYAQOVFL-MDWZMJQESA-N |
| XLogP | 3.32 |
| TPSA | 68.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.31 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|