C14H17NO3S — CID 78784574
3-methylsulfonyl-N,N-bis(prop-2-enyl)benzamide (PubChem CID 78784574) has the molecular formula C14H17NO3S and a molecular weight of 279.36 g/mol. Its IUPAC name is 3-methylsulfonyl-N,N-bis(prop-2-enyl)benzamide.
| Compound Name | 3-methylsulfonyl-N,N-bis(prop-2-enyl)benzamide |
|---|---|
| PubChem CID | 78784574 |
| Molecular Formula | C14H17NO3S |
| Molecular Weight | 279.36 g/mol |
| Exact Mass | 279.09 |
| IUPAC Name | 3-methylsulfonyl-N,N-bis(prop-2-enyl)benzamide |
| SMILES | C=CCN(CC=C)C(=O)c1cccc(S(C)(=O)=O)c1 |
| InChI | InChI=1S/C14H17NO3S/c1-4-9-15(10-5-2)14(16)12-7-6-8-13(11-12)19(3,17)18/h4-8,11H,1-2,9-10H2,3H3 |
| InChIKey | QDRWNGGIGONGPB-UHFFFAOYSA-N |
| XLogP | 1.90 |
| TPSA | 54.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.36 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|