C18H14F2N2O2 — CID 78786001
(Z)-2-cyano-3-(2,4-difluorophenyl)-N-(2-ethoxyphenyl)prop-2-enamide (PubChem CID 78786001) has the molecular formula C18H14F2N2O2 and a molecular weight of 328.32 g/mol. Its IUPAC name is (Z)-2-cyano-3-(2,4-difluorophenyl)-N-(2-ethoxyphenyl)prop-2-enamide.
| Compound Name | (Z)-2-cyano-3-(2,4-difluorophenyl)-N-(2-ethoxyphenyl)prop-2-enamide |
|---|---|
| PubChem CID | 78786001 |
| Molecular Formula | C18H14F2N2O2 |
| Molecular Weight | 328.32 g/mol |
| Exact Mass | 328.10 |
| IUPAC Name | (Z)-2-cyano-3-(2,4-difluorophenyl)-N-(2-ethoxyphenyl)prop-2-enamide |
| SMILES | CCOc1ccccc1NC(=O)/C(C#N)=C\c1ccc(F)cc1F |
| InChI | InChI=1S/C18H14F2N2O2/c1-2-24-17-6-4-3-5-16(17)22-18(23)13(11-21)9-12-7-8-14(19)10-15(12)20/h3-10H,2H2,1H3,(H,22,23)/b13-9- |
| InChIKey | IZDPVVDYABTHMV-LCYFTJDESA-N |
| XLogP | 3.91 |
| TPSA | 62.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.32 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|