C20H19ClN4O3S — CID 78787992
2-[2-(1,3-benzothiazol-2-yl)pyrrolidin-1-yl]-N-(2-chloro-5-nitrophenyl)propanamide (PubChem CID 78787992) has the molecular formula C20H19ClN4O3S and a molecular weight of 430.92 g/mol. Its IUPAC name is 2-[2-(1,3-benzothiazol-2-yl)pyrrolidin-1-yl]-N-(2-chloro-5-nitrophenyl)propanamide.
| Compound Name | 2-[2-(1,3-benzothiazol-2-yl)pyrrolidin-1-yl]-N-(2-chloro-5-nitrophenyl)propanamide |
|---|---|
| PubChem CID | 78787992 |
| Molecular Formula | C20H19ClN4O3S |
| Molecular Weight | 430.92 g/mol |
| Exact Mass | 430.09 |
| IUPAC Name | 2-[2-(1,3-benzothiazol-2-yl)pyrrolidin-1-yl]-N-(2-chloro-5-nitrophenyl)propanamide |
| SMILES | CC(C(=O)Nc1cc([N+](=O)[O-])ccc1Cl)N1CCCC1c1nc2ccccc2s1 |
| InChI | InChI=1S/C20H19ClN4O3S/c1-12(19(26)22-16-11-13(25(27)28)8-9-14(16)21)24-10-4-6-17(24)20-23-15-5-2-3-7-18(15)29-20/h2-3,5,7-9,11-12,17H,4,6,10H2,1H3,(H,22,26) |
| InChIKey | BJCDOTCKZBEYKO-UHFFFAOYSA-N |
| XLogP | 5.02 |
| TPSA | 88.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.92 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|