C20H20N4O2S — CID 78797290
2-[[2-[1-(2,5-dimethylphenyl)imidazol-2-yl]sulfanylacetyl]amino]benzamide (PubChem CID 78797290) has the molecular formula C20H20N4O2S and a molecular weight of 380.47 g/mol. Its IUPAC name is 2-[[2-[1-(2,5-dimethylphenyl)imidazol-2-yl]sulfanylacetyl]amino]benzamide.
| Compound Name | 2-[[2-[1-(2,5-dimethylphenyl)imidazol-2-yl]sulfanylacetyl]amino]benzamide |
|---|---|
| PubChem CID | 78797290 |
| Molecular Formula | C20H20N4O2S |
| Molecular Weight | 380.47 g/mol |
| Exact Mass | 380.13 |
| IUPAC Name | 2-[[2-[1-(2,5-dimethylphenyl)imidazol-2-yl]sulfanylacetyl]amino]benzamide |
| SMILES | Cc1ccc(C)c(-n2ccnc2SCC(=O)Nc2ccccc2C(N)=O)c1 |
| InChI | InChI=1S/C20H20N4O2S/c1-13-7-8-14(2)17(11-13)24-10-9-22-20(24)27-12-18(25)23-16-6-4-3-5-15(16)19(21)26/h3-11H,12H2,1-2H3,(H2,21,26)(H,23,25) |
| InChIKey | PRGCCNXREPERNQ-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 90.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.47 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |