C19H18N4O2S — CID 78797782
2-[[2-[1-(2-methylphenyl)imidazol-2-yl]sulfanylacetyl]amino]benzamide (PubChem CID 78797782) has the molecular formula C19H18N4O2S and a molecular weight of 366.45 g/mol. Its IUPAC name is 2-[[2-[1-(2-methylphenyl)imidazol-2-yl]sulfanylacetyl]amino]benzamide.
| Compound Name | 2-[[2-[1-(2-methylphenyl)imidazol-2-yl]sulfanylacetyl]amino]benzamide |
|---|---|
| PubChem CID | 78797782 |
| Molecular Formula | C19H18N4O2S |
| Molecular Weight | 366.45 g/mol |
| Exact Mass | 366.12 |
| IUPAC Name | 2-[[2-[1-(2-methylphenyl)imidazol-2-yl]sulfanylacetyl]amino]benzamide |
| SMILES | Cc1ccccc1-n1ccnc1SCC(=O)Nc1ccccc1C(N)=O |
| InChI | InChI=1S/C19H18N4O2S/c1-13-6-2-5-9-16(13)23-11-10-21-19(23)26-12-17(24)22-15-8-4-3-7-14(15)18(20)25/h2-11H,12H2,1H3,(H2,20,25)(H,22,24) |
| InChIKey | GKVPPPGPQHPXJO-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 90.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.45 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |