C21H22N4O2S — CID 55846055
N-(3-acetamido-4-methylphenyl)-2-[1-(2-methylphenyl)imidazol-2-yl]sulfanylacetamide (PubChem CID 55846055) has the molecular formula C21H22N4O2S and a molecular weight of 394.50 g/mol. Its IUPAC name is N-(3-acetamido-4-methylphenyl)-2-[1-(2-methylphenyl)imidazol-2-yl]sulfanylacetamide.
| Compound Name | N-(3-acetamido-4-methylphenyl)-2-[1-(2-methylphenyl)imidazol-2-yl]sulfanylacetamide |
|---|---|
| PubChem CID | 55846055 |
| Molecular Formula | C21H22N4O2S |
| Molecular Weight | 394.50 g/mol |
| Exact Mass | 394.15 |
| IUPAC Name | N-(3-acetamido-4-methylphenyl)-2-[1-(2-methylphenyl)imidazol-2-yl]sulfanylacetamide |
| SMILES | CC(=O)Nc1cc(NC(=O)CSc2nccn2-c2ccccc2C)ccc1C |
| InChI | InChI=1S/C21H22N4O2S/c1-14-8-9-17(12-18(14)23-16(3)26)24-20(27)13-28-21-22-10-11-25(21)19-7-5-4-6-15(19)2/h4-12H,13H2,1-3H3,(H,23,26)(H,24,27) |
| InChIKey | ZHVJIERGEDZVPY-UHFFFAOYSA-N |
| XLogP | 4.18 |
| TPSA | 76.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.50 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |