C22H26N2O5 — CID 78798897
1-(furan-2-ylmethyl)-N-[(2-hydroxyphenyl)methyl]-5-oxo-N-(oxolan-2-ylmethyl)pyrrolidine-3-carboxamide (PubChem CID 78798897) has the molecular formula C22H26N2O5 and a molecular weight of 398.46 g/mol. Its IUPAC name is 1-(furan-2-ylmethyl)-N-[(2-hydroxyphenyl)methyl]-5-oxo-N-(oxolan-2-ylmethyl)pyrrolidine-3-carboxamide.
| Compound Name | 1-(furan-2-ylmethyl)-N-[(2-hydroxyphenyl)methyl]-5-oxo-N-(oxolan-2-ylmethyl)pyrrolidine-3-carboxamide |
|---|---|
| PubChem CID | 78798897 |
| Molecular Formula | C22H26N2O5 |
| Molecular Weight | 398.46 g/mol |
| Exact Mass | 398.18 |
| IUPAC Name | 1-(furan-2-ylmethyl)-N-[(2-hydroxyphenyl)methyl]-5-oxo-N-(oxolan-2-ylmethyl)pyrrolidine-3-carboxamide |
| SMILES | O=C1CC(C(=O)N(Cc2ccccc2O)CC2CCCO2)CN1Cc1ccco1 |
| InChI | InChI=1S/C22H26N2O5/c25-20-8-2-1-5-16(20)12-24(15-19-7-4-10-29-19)22(27)17-11-21(26)23(13-17)14-18-6-3-9-28-18/h1-3,5-6,8-9,17,19,25H,4,7,10-15H2 |
| InChIKey | VSFOXZPUFUWOAQ-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 83.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.46 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|